CAS: 2835-95-2
MT
2921421000
2835-95-2
Availability: | |
---|---|
High Purity 99.5%min 5-Amino-o-cresol 3-hydroxy -4-methylaniline Cas 2835-95-2 with Steady Supply
Description
product Name | 5-amino-2-methylphenol |
---|---|
Synonyms | 5-Amino-o-cresol; 2-methyl-5-aminophenol; 2-amino-5-methylphenol |
Molecular Formula | C7H9NO |
Molecular Weight | 123.1525 |
InChI | InChI=1/C7H9NO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,8H2,1H3 |
CAS Registry Number | 2835-95-2 |
EINECS | 220-618-6 |
Molecular Structure | |
Density | 1.157g/cm3 |
Melting point | 160-165°C |
Boiling point | 241.4°C at 760 mmHg |
Refractive index | 1.616 |
Flash point | 99.8°C |
Vapour Pressur | 0.0232mmHg at 25°C |
Packing and Shipping:
High Purity 99.5%min 5-Amino-o-cresol 3-hydroxy -4-methylaniline Cas 2835-95-2 with Steady Supply
Description
product Name | 5-amino-2-methylphenol |
---|---|
Synonyms | 5-Amino-o-cresol; 2-methyl-5-aminophenol; 2-amino-5-methylphenol |
Molecular Formula | C7H9NO |
Molecular Weight | 123.1525 |
InChI | InChI=1/C7H9NO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,8H2,1H3 |
CAS Registry Number | 2835-95-2 |
EINECS | 220-618-6 |
Molecular Structure | |
Density | 1.157g/cm3 |
Melting point | 160-165°C |
Boiling point | 241.4°C at 760 mmHg |
Refractive index | 1.616 |
Flash point | 99.8°C |
Vapour Pressur | 0.0232mmHg at 25°C |
Packing and Shipping: